C17H20BrNO5 — CID 101030323
(4R)-4-benzyl-3-[(2S)-2-bromo-2-[(2S,5S)-5-(hydroxymethyl)oxolan-2-yl]acetyl]-1,3-oxazolidin-2-one (PubChem CID 101030323) has the molecular formula C17H20BrNO5 and a molecular weight of 398.25 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2S)-2-bromo-2-[(2S,5S)-5-(hydroxymethyl)oxolan-2-yl]acetyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2S)-2-bromo-2-[(2S,5S)-5-(hydroxymethyl)oxolan-2-yl]acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101030323 |
| Molecular Formula | C17H20BrNO5 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | (4R)-4-benzyl-3-[(2S)-2-bromo-2-[(2S,5S)-5-(hydroxymethyl)oxolan-2-yl]acetyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](Cc2ccccc2)N1C(=O)[C@@H](Br)[C@@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C17H20BrNO5/c18-15(14-7-6-13(9-20)24-14)16(21)19-12(10-23-17(19)22)8-11-4-2-1-3-5-11/h1-5,12-15,20H,6-10H2/t12-,13+,14+,15+/m1/s1 |
| InChIKey | MCNMMHMKZHGGQQ-QPSCCSFWSA-N |
| XLogP | 1.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|