C24H42O2Si — CID 101030785
triethyl-[(3S,4E,8S)-4,8,10-trimethyl-6-methylidene-9-propa-1,2-dienoxyundeca-4,10-dien-3-yl]oxysilane (PubChem CID 101030785) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is triethyl-[(3S,4E,8S)-4,8,10-trimethyl-6-methylidene-9-propa-1,2-dienoxyundeca-4,10-dien-3-yl]oxysilane.
| Compound Name | triethyl-[(3S,4E,8S)-4,8,10-trimethyl-6-methylidene-9-propa-1,2-dienoxyundeca-4,10-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 101030785 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | triethyl-[(3S,4E,8S)-4,8,10-trimethyl-6-methylidene-9-propa-1,2-dienoxyundeca-4,10-dien-3-yl]oxysilane |
| SMILES | C=C=COC(C(=C)C)[C@@H](C)CC(=C)/C=C(\C)[C@H](CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H42O2Si/c1-11-16-25-24(19(6)7)22(10)18-20(8)17-21(9)23(12-2)26-27(13-3,14-4)15-5/h16-17,22-24H,1,6,8,12-15,18H2,2-5,7,9-10H3/b21-17+/t22-,23-,24?/m0/s1 |
| InChIKey | CNQOOHVBOQFVMR-XBPWVVAASA-N |
| XLogP | 7.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|