C32H42O2Se2 — CID 101030881
4-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 101030881) has the molecular formula C32H42O2Se2 and a molecular weight of 616.61 g/mol. Its IUPAC name is 4-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | 4-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 101030881 |
| Molecular Formula | C32H42O2Se2 |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | 4-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CC(C)(C)C1=CC(=CC2=C([O-])C(=Cc3cc(C(C)(C)C)[se+]c(C(C)(C)C)c3)C2=O)C=C(C(C)(C)C)[Se]1 |
| InChI | InChI=1S/C32H42O2Se2/c1-29(2,3)23-15-19(16-24(35-23)30(4,5)6)13-21-27(33)22(28(21)34)14-20-17-25(31(7,8)9)36-26(18-20)32(10,11)12/h13-18H,1-12H3 |
| InChIKey | BGTPHSAVKNWGGF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|