C12H16O2 — CID 101030907
3-methylbut-2-enyl (1R,5S,6R)-bicyclo[3.1.0]hex-2-ene-6-carboxylate (PubChem CID 101030907) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-methylbut-2-enyl (1R,5S,6R)-bicyclo[3.1.0]hex-2-ene-6-carboxylate.
| Compound Name | 3-methylbut-2-enyl (1R,5S,6R)-bicyclo[3.1.0]hex-2-ene-6-carboxylate |
|---|---|
| PubChem CID | 101030907 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-methylbut-2-enyl (1R,5S,6R)-bicyclo[3.1.0]hex-2-ene-6-carboxylate |
| SMILES | CC(C)=CCOC(=O)[C@H]1[C@@H]2C=CC[C@@H]21 |
| InChI | InChI=1S/C12H16O2/c1-8(2)6-7-14-12(13)11-9-4-3-5-10(9)11/h3-4,6,9-11H,5,7H2,1-2H3/t9-,10+,11+/m1/s1 |
| InChIKey | OUYUMMOVRPERLT-VWYCJHECSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|