About (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine
(2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine (PubChem CID 101031220) has the molecular formula C23H34ClNOSi
and a molecular weight of 404.07 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine.
Molecular Properties
| Compound Name | (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine |
| PubChem CID | 101031220 |
| Molecular Formula | C23H34ClNOSi |
| Molecular Weight | 404.07 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](Cl)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H34ClNOSi/c1-23(2,3)27(4,5)26-19-22(24)18-25(16-20-12-8-6-9-13-20)17-21-14-10-7-11-15-21/h6-15,22H,16-19H2,1-5H3/t22-/m0/s1 |
| InChIKey | ALWFZVZNZCIRET-QFIPXVFZSA-N |
| XLogP | 6.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.07 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine?
The IUPAC name of (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine (CID 101031220) is (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine.
What is the SMILES notation for (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine?
The canonical SMILES for (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine is CC(C)(C)[Si](C)(C)OC[C@@H](Cl)CN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine?
The InChIKey is ALWFZVZNZCIRET-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H34ClNOSi/c1-23(2,3)27(4,5)26-19-22(24)18-25(16-20-12-8-6-9-13-20)17-21-14-10-7-11-15-21/h6-15,22H,16-19H2,1-5H3/t22-/m0/s1.
What are the key properties of (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine?
(2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine has a molecular weight of 404.07 g/mol, XLogP of 6.32, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dibenzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-chloropropan-1-amine is sourced from PubChem (CID 101031220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).