About propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide
propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide (PubChem CID 101031528) has the molecular formula C13H19N2-
and a molecular weight of 203.31 g/mol. Its IUPAC name is propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide.
Molecular Properties
| Compound Name | propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide |
| PubChem CID | 101031528 |
| Molecular Formula | C13H19N2- |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide |
| SMILES | CC(C)/N=c1\cccccc1[N-]C(C)C |
| InChI | InChI=1S/C13H19N2/c1-10(2)14-12-8-6-5-7-9-13(12)15-11(3)4/h5-11H,1-4H3/q-1 |
| InChIKey | YJOMQLPDSQHSDB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide?
The IUPAC name of propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide (CID 101031528) is propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide.
What is the SMILES notation for propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide?
The canonical SMILES for propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide is CC(C)/N=c1\cccccc1[N-]C(C)C.
What is the InChIKey of propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide?
The InChIKey is YJOMQLPDSQHSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N2/c1-10(2)14-12-8-6-5-7-9-13(12)15-11(3)4/h5-11H,1-4H3/q-1.
What are the key properties of propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide?
propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide has a molecular weight of 203.31 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide is sourced from PubChem (CID 101031528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).