C18H23NO3 — CID 101031643
2-[2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylcarbamoyl]benzoic acid (PubChem CID 101031643) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylcarbamoyl]benzoic acid.
| Compound Name | 2-[2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 101031643 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylcarbamoyl]benzoic acid |
| SMILES | CC1=CC[C@@H](CCNC(=O)c2ccccc2C(=O)O)C1(C)C |
| InChI | InChI=1S/C18H23NO3/c1-12-8-9-13(18(12,2)3)10-11-19-16(20)14-6-4-5-7-15(14)17(21)22/h4-8,13H,9-11H2,1-3H3,(H,19,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | UIWIOHZVVUJLKI-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|