About (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane
(4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane (PubChem CID 101031939) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane.
Molecular Properties
| Compound Name | (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane |
| PubChem CID | 101031939 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane |
| SMILES | CCC1CC(COC)(COC)C/C1=C/C=C(C)C |
| InChI | InChI=1S/C16H28O2/c1-6-14-9-16(11-17-4,12-18-5)10-15(14)8-7-13(2)3/h7-8,14H,6,9-12H2,1-5H3/b15-8- |
| InChIKey | QOMNIBHMBSUOIB-NVNXTCNLSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane?
The IUPAC name of (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane (CID 101031939) is (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane.
What is the SMILES notation for (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane?
The canonical SMILES for (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane is CCC1CC(COC)(COC)C/C1=C/C=C(C)C.
What is the InChIKey of (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane?
The InChIKey is QOMNIBHMBSUOIB-NVNXTCNLSA-N. The full InChI is InChI=1S/C16H28O2/c1-6-14-9-16(11-17-4,12-18-5)10-15(14)8-7-13(2)3/h7-8,14H,6,9-12H2,1-5H3/b15-8-.
What are the key properties of (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane?
(4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane has a molecular weight of 252.40 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3-ethyl-1,1-bis(methoxymethyl)-4-(3-methylbut-2-enylidene)cyclopentane is sourced from PubChem (CID 101031939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).