C16H22F3NOSi — CID 101032745
N-[(E)-5-[benzyl(dimethyl)silyl]pent-4-enyl]-2,2,2-trifluoroacetamide (PubChem CID 101032745) has the molecular formula C16H22F3NOSi and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[(E)-5-[benzyl(dimethyl)silyl]pent-4-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E)-5-[benzyl(dimethyl)silyl]pent-4-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101032745 |
| Molecular Formula | C16H22F3NOSi |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[(E)-5-[benzyl(dimethyl)silyl]pent-4-enyl]-2,2,2-trifluoroacetamide |
| SMILES | C[Si](C)(/C=C/CCCNC(=O)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C16H22F3NOSi/c1-22(2,13-14-9-5-3-6-10-14)12-8-4-7-11-20-15(21)16(17,18)19/h3,5-6,8-10,12H,4,7,11,13H2,1-2H3,(H,20,21)/b12-8+ |
| InChIKey | QHXQDNLIYUEVTA-XYOKQWHBSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|