C11H4F10N2 — CID 101033013
2,4-difluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)pyrido[1,2-a]pyrimidine (PubChem CID 101033013) has the molecular formula C11H4F10N2 and a molecular weight of 354.15 g/mol. Its IUPAC name is 2,4-difluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)pyrido[1,2-a]pyrimidine.
| Compound Name | 2,4-difluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 101033013 |
| Molecular Formula | C11H4F10N2 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2,4-difluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)pyrido[1,2-a]pyrimidine |
| SMILES | FC1=C(C(F)(F)F)C(F)(C(F)(F)C(F)(F)F)N2C=CC=CC2=N1 |
| InChI | InChI=1S/C11H4F10N2/c12-7-6(9(14,15)16)8(13,10(17,18)11(19,20)21)23-4-2-1-3-5(23)22-7/h1-4H |
| InChIKey | IYJITXDURBWUJO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|