C29H21N3O3S — CID 101033746
benzhydryl (2R,6R,7Z)-3-[(E)-2-cyanoethenyl]-8-oxo-7-(pyridin-2-ylmethylidene)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 101033746) has the molecular formula C29H21N3O3S and a molecular weight of 491.57 g/mol. Its IUPAC name is benzhydryl (2R,6R,7Z)-3-[(E)-2-cyanoethenyl]-8-oxo-7-(pyridin-2-ylmethylidene)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | benzhydryl (2R,6R,7Z)-3-[(E)-2-cyanoethenyl]-8-oxo-7-(pyridin-2-ylmethylidene)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 101033746 |
| Molecular Formula | C29H21N3O3S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | benzhydryl (2R,6R,7Z)-3-[(E)-2-cyanoethenyl]-8-oxo-7-(pyridin-2-ylmethylidene)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | N#C/C=C/C1=CS[C@@H]2/C(=C\c3ccccn3)C(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H21N3O3S/c30-16-9-14-22-19-36-28-24(18-23-15-7-8-17-31-23)27(33)32(28)25(22)29(34)35-26(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-15,17-19,25-26,28H/b14-9+,24-18-/t25-,28-/m1/s1 |
| InChIKey | XTMUTBIHZJFUGC-ZKQXUJJZSA-N |
| XLogP | 5.05 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|