C14H16N2O — CID 101034091
7-methyl-11-oxa-2,7-diazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),3,12(16),13-tetraene (PubChem CID 101034091) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 7-methyl-11-oxa-2,7-diazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),3,12(16),13-tetraene.
| Compound Name | 7-methyl-11-oxa-2,7-diazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),3,12(16),13-tetraene |
|---|---|
| PubChem CID | 101034091 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 7-methyl-11-oxa-2,7-diazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(15),3,12(16),13-tetraene |
| SMILES | CN1CCc2c[nH]c3ccc4c(c23)C1CCO4 |
| InChI | InChI=1S/C14H16N2O/c1-16-6-4-9-8-15-10-2-3-12-14(13(9)10)11(16)5-7-17-12/h2-3,8,11,15H,4-7H2,1H3 |
| InChIKey | UQGLOLXMOVEIJD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |