About trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium
trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium (PubChem CID 10103411) has the molecular formula C9H20NO+
and a molecular weight of 158.26 g/mol. Its IUPAC name is trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium.
Molecular Properties
| Compound Name | trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium |
| PubChem CID | 10103411 |
| Molecular Formula | C9H20NO+ |
| Molecular Weight | 158.26 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium |
| SMILES | C[C@H]1CC[C@@H](C[N+](C)(C)C)O1 |
| InChI | InChI=1S/C9H20NO/c1-8-5-6-9(11-8)7-10(2,3)4/h8-9H,5-7H2,1-4H3/q+1/t8-,9-/m0/s1 |
| InChIKey | UCRHCZYMNXEZGQ-IUCAKERBSA-N |
| XLogP | 1.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium?
The IUPAC name of trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium (CID 10103411) is trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium.
What is the SMILES notation for trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium?
The canonical SMILES for trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium is C[C@H]1CC[C@@H](C[N+](C)(C)C)O1.
What is the InChIKey of trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium?
The InChIKey is UCRHCZYMNXEZGQ-IUCAKERBSA-N. The full InChI is InChI=1S/C9H20NO/c1-8-5-6-9(11-8)7-10(2,3)4/h8-9H,5-7H2,1-4H3/q+1/t8-,9-/m0/s1.
What are the key properties of trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium?
trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium has a molecular weight of 158.26 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[[(2S,5S)-5-methyloxolan-2-yl]methyl]azanium is sourced from PubChem (CID 10103411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).