About 3,3-dinitro-2,2-diphenylpropanenitrile
3,3-dinitro-2,2-diphenylpropanenitrile (PubChem CID 101034284) has the molecular formula C15H11N3O4
and a molecular weight of 297.27 g/mol. Its IUPAC name is 3,3-dinitro-2,2-diphenylpropanenitrile.
Molecular Properties
| Compound Name | 3,3-dinitro-2,2-diphenylpropanenitrile |
| PubChem CID | 101034284 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3,3-dinitro-2,2-diphenylpropanenitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N3O4/c16-11-15(12-7-3-1-4-8-12,13-9-5-2-6-10-13)14(17(19)20)18(21)22/h1-10,14H |
| InChIKey | MMAQQNDXOKKBPR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dinitro-2,2-diphenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dinitro-2,2-diphenylpropanenitrile?
The IUPAC name of 3,3-dinitro-2,2-diphenylpropanenitrile (CID 101034284) is 3,3-dinitro-2,2-diphenylpropanenitrile.
What is the SMILES notation for 3,3-dinitro-2,2-diphenylpropanenitrile?
The canonical SMILES for 3,3-dinitro-2,2-diphenylpropanenitrile is N#CC(c1ccccc1)(c1ccccc1)C([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 3,3-dinitro-2,2-diphenylpropanenitrile?
The InChIKey is MMAQQNDXOKKBPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O4/c16-11-15(12-7-3-1-4-8-12,13-9-5-2-6-10-13)14(17(19)20)18(21)22/h1-10,14H.
What are the key properties of 3,3-dinitro-2,2-diphenylpropanenitrile?
3,3-dinitro-2,2-diphenylpropanenitrile has a molecular weight of 297.27 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dinitro-2,2-diphenylpropanenitrile is sourced from PubChem (CID 101034284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).