C11H14O — CID 10103457
(3R,5R,8R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol (PubChem CID 10103457) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (3R,5R,8R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol.
| Compound Name | (3R,5R,8R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol |
|---|---|
| PubChem CID | 10103457 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3R,5R,8R)-pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol |
| SMILES | OC1C2C3CC4C1[C@@H]1C[C@H]4C3C21 |
| InChI | InChI=1S/C11H14O/c12-11-8-4-2-5-7-3(4)1-6(8)9(7)10(5)11/h3-12H,1-2H2/t3-,4?,5?,6+,7?,8?,9?,10?,11?/m1/s1 |
| InChIKey | HPPCKQCWRBPJIB-LOMPXPEFSA-N |
| XLogP | 1.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |