About 2-methyl-3,4-dihydro-2H-quinolin-1-amine
2-methyl-3,4-dihydro-2H-quinolin-1-amine (PubChem CID 10103459) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-quinolin-1-amine.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-quinolin-1-amine |
| PubChem CID | 10103459 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-quinolin-1-amine |
| SMILES | CC1CCc2ccccc2N1N |
| InChI | InChI=1S/C10H14N2/c1-8-6-7-9-4-2-3-5-10(9)12(8)11/h2-5,8H,6-7,11H2,1H3 |
| InChIKey | RLBRHMPJAZEEKD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,4-dihydro-2H-quinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-quinolin-1-amine?
The IUPAC name of 2-methyl-3,4-dihydro-2H-quinolin-1-amine (CID 10103459) is 2-methyl-3,4-dihydro-2H-quinolin-1-amine.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-quinolin-1-amine?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-quinolin-1-amine is CC1CCc2ccccc2N1N.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-quinolin-1-amine?
The InChIKey is RLBRHMPJAZEEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-8-6-7-9-4-2-3-5-10(9)12(8)11/h2-5,8H,6-7,11H2,1H3.
What are the key properties of 2-methyl-3,4-dihydro-2H-quinolin-1-amine?
2-methyl-3,4-dihydro-2H-quinolin-1-amine has a molecular weight of 162.24 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-quinolin-1-amine is sourced from PubChem (CID 10103459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).