C10H13NO — CID 10103467
[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol (PubChem CID 10103467) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is [(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol.
| Compound Name | [(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol |
|---|---|
| PubChem CID | 10103467 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol |
| SMILES | OC[C@@H]1CCc2ccccc2N1 |
| InChI | InChI=1S/C10H13NO/c12-7-9-6-5-8-3-1-2-4-10(8)11-9/h1-4,9,11-12H,5-7H2/t9-/m0/s1 |
| InChIKey | QSDYZRIUFBMUGV-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |