C14H24O3 — CID 101035369
3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,6-dihydro-1,2-dioxine (PubChem CID 101035369) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,6-dihydro-1,2-dioxine.
| Compound Name | 3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,6-dihydro-1,2-dioxine |
|---|---|
| PubChem CID | 101035369 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,6-dihydro-1,2-dioxine |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC1C=CCOO1 |
| InChI | InChI=1S/C14H24O3/c1-10(2)12-7-6-11(3)9-13(12)16-14-5-4-8-15-17-14/h4-5,10-14H,6-9H2,1-3H3/t11-,12+,13-,14?/m0/s1 |
| InChIKey | HYAOTOPOTHKFJZ-WJLOJVBCSA-N |
| XLogP | 3.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|