About CID 101035751
CID 101035751 (PubChem CID 101035751) has the molecular formula C11H21OSi
and a molecular weight of 197.37 g/mol.
Molecular Properties
| Compound Name | CID 101035751 |
| PubChem CID | 101035751 |
| Molecular Formula | C11H21OSi |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | — |
| SMILES | [C]#CC(C)(C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C11H21OSi/c1-7-11(5,6)12-13(8-2,9-3)10-4/h8-10H2,2-6H3 |
| InChIKey | XSZLBJGYQOOKGN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 101035751 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101035751?
The IUPAC name of CID 101035751 (CID 101035751) is not available.
What is the SMILES notation for CID 101035751?
The canonical SMILES for CID 101035751 is [C]#CC(C)(C)O[Si](CC)(CC)CC.
What is the InChIKey of CID 101035751?
The InChIKey is XSZLBJGYQOOKGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21OSi/c1-7-11(5,6)12-13(8-2,9-3)10-4/h8-10H2,2-6H3.
What are the key properties of CID 101035751?
CID 101035751 has a molecular weight of 197.37 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101035751 is sourced from PubChem (CID 101035751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).