About 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide
2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide (PubChem CID 10103589) has the molecular formula C9H14OS
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide.
Molecular Properties
| Compound Name | 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide |
| PubChem CID | 10103589 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide |
| SMILES | O=S1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C9H14OS/c10-11-8-2-6-1-7(4-8)5-9(11)3-6/h6-9H,1-5H2 |
| InChIKey | DSVJWGWYGUTZBG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide?
The IUPAC name of 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide (CID 10103589) is 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide.
What is the SMILES notation for 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide?
The canonical SMILES for 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide is O=S1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide?
The InChIKey is DSVJWGWYGUTZBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14OS/c10-11-8-2-6-1-7(4-8)5-9(11)3-6/h6-9H,1-5H2.
What are the key properties of 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide?
2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide has a molecular weight of 170.28 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2lambda4-thiatricyclo[3.3.1.13,7]decane 2-oxide is sourced from PubChem (CID 10103589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).