About 1-phenylhex-5-en-3-ol
1-phenylhex-5-en-3-ol (PubChem CID 10103699) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-phenylhex-5-en-3-ol.
Molecular Properties
| Compound Name | 1-phenylhex-5-en-3-ol |
| PubChem CID | 10103699 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-phenylhex-5-en-3-ol |
| SMILES | C=CCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C12H16O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h2-5,7-8,12-13H,1,6,9-10H2 |
| InChIKey | AYQFIGASVMPYQZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylhex-5-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylhex-5-en-3-ol?
The IUPAC name of 1-phenylhex-5-en-3-ol (CID 10103699) is 1-phenylhex-5-en-3-ol.
What is the SMILES notation for 1-phenylhex-5-en-3-ol?
The canonical SMILES for 1-phenylhex-5-en-3-ol is C=CCC(O)CCc1ccccc1.
What is the InChIKey of 1-phenylhex-5-en-3-ol?
The InChIKey is AYQFIGASVMPYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h2-5,7-8,12-13H,1,6,9-10H2.
What are the key properties of 1-phenylhex-5-en-3-ol?
1-phenylhex-5-en-3-ol has a molecular weight of 176.26 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhex-5-en-3-ol is sourced from PubChem (CID 10103699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).