About (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one
(5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one (PubChem CID 101037409) has the molecular formula C14H26OSi
and a molecular weight of 238.45 g/mol. Its IUPAC name is (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one.
Molecular Properties
| Compound Name | (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one |
| PubChem CID | 101037409 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one |
| SMILES | CCCC/C(=C\C(=O)C=C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H26OSi/c1-7-8-9-14(16(4,5)6)11-13(15)10-12(2)3/h10-11H,7-9H2,1-6H3/b14-11+ |
| InChIKey | NEZQBRIOLMXFOQ-SDNWHVSQSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one?
The IUPAC name of (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one (CID 101037409) is (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one.
What is the SMILES notation for (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one?
The canonical SMILES for (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one is CCCC/C(=C\C(=O)C=C(C)C)[Si](C)(C)C.
What is the InChIKey of (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one?
The InChIKey is NEZQBRIOLMXFOQ-SDNWHVSQSA-N. The full InChI is InChI=1S/C14H26OSi/c1-7-8-9-14(16(4,5)6)11-13(15)10-12(2)3/h10-11H,7-9H2,1-6H3/b14-11+.
What are the key properties of (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one?
(5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one has a molecular weight of 238.45 g/mol, XLogP of 4.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2-methyl-6-trimethylsilyldeca-2,5-dien-4-one is sourced from PubChem (CID 101037409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).