C17H27NO3 — CID 101037867
2-[(1'R,3'aR,6'aR)-5,5-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-1'-yl]-N,N-dimethylacetamide (PubChem CID 101037867) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[(1'R,3'aR,6'aR)-5,5-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-1'-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1'R,3'aR,6'aR)-5,5-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-1'-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 101037867 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-[(1'R,3'aR,6'aR)-5,5-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-1'-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[C@@H]1C=C[C@H]2CC3(C[C@@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C17H27NO3/c1-16(2)10-20-17(21-11-16)8-13-6-5-12(14(13)9-17)7-15(19)18(3)4/h5-6,12-14H,7-11H2,1-4H3/t12-,13-,14-/m0/s1 |
| InChIKey | CHHLAYPAYXCPSF-IHRRRGAJSA-N |
| XLogP | 2.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|