C28H46N2O13P- — CID 101038404
1-[(2R,3R,4S,5R)-5-[[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-olate (PubChem CID 101038404) has the molecular formula C28H46N2O13P- and a molecular weight of 649.65 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-olate.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-olate |
|---|---|
| PubChem CID | 101038404 |
| Molecular Formula | C28H46N2O13P- |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[[[(2R)-2,3-di(octanoyloxy)propoxy]-hydroxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-olate |
| SMILES | CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H]1O[C@@H](n2ccc([O-])nc2=O)[C@H](O)[C@@H]1O)OC(=O)CCCCCCC |
| InChI | InChI=1S/C28H47N2O13P/c1-3-5-7-9-11-13-23(32)39-17-20(42-24(33)14-12-10-8-6-4-2)18-40-44(37,38)41-19-21-25(34)26(35)27(43-21)30-16-15-22(31)29-28(30)36/h15-16,20-21,25-27,34-35H,3-14,17-19H2,1-2H3,(H,37,38)(H,29,31,36)/p-1/t20-,21-,25-,26-,27-/m1/s1 |
| InChIKey | DSMXSOSAEIHINP-ZMFAMYDGSA-M |
| XLogP | 2.25 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|