C32H42O4SSi — CID 101038654
[(2S,6S)-6-[(2R)-1-(benzenesulfonyl)butan-2-yl]oxan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 101038654) has the molecular formula C32H42O4SSi and a molecular weight of 550.84 g/mol. Its IUPAC name is [(2S,6S)-6-[(2R)-1-(benzenesulfonyl)butan-2-yl]oxan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,6S)-6-[(2R)-1-(benzenesulfonyl)butan-2-yl]oxan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101038654 |
| Molecular Formula | C32H42O4SSi |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [(2S,6S)-6-[(2R)-1-(benzenesulfonyl)butan-2-yl]oxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CCC(CS(=O)(=O)c1ccccc1)[C@@H]1CCC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C32H42O4SSi/c1-5-26(25-37(33,34)28-17-9-6-10-18-28)31-23-15-16-27(36-31)24-35-38(32(2,3)4,29-19-11-7-12-20-29)30-21-13-8-14-22-30/h6-14,17-22,26-27,31H,5,15-16,23-25H2,1-4H3/t26?,27-,31-/m0/s1 |
| InChIKey | QJZCAXSPLNFGBR-XTEJFLLXSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|