About 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one
5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one (PubChem CID 10103893) has the molecular formula C9H6N4O
and a molecular weight of 186.17 g/mol. Its IUPAC name is 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one.
Molecular Properties
| Compound Name | 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one |
| PubChem CID | 10103893 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one |
| SMILES | O=c1[nH]c2ccccc2n2ncnc12 |
| InChI | InChI=1S/C9H6N4O/c14-9-8-10-5-11-13(8)7-4-2-1-3-6(7)12-9/h1-5H,(H,12,14) |
| InChIKey | OEIMIUHARCZWJY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one?
The IUPAC name of 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one (CID 10103893) is 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one.
What is the SMILES notation for 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one?
The canonical SMILES for 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one is O=c1[nH]c2ccccc2n2ncnc12.
What is the InChIKey of 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one?
The InChIKey is OEIMIUHARCZWJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O/c14-9-8-10-5-11-13(8)7-4-2-1-3-6(7)12-9/h1-5H,(H,12,14).
What are the key properties of 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one?
5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one has a molecular weight of 186.17 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-[1,2,4]triazolo[1,5-a]quinoxalin-4-one is sourced from PubChem (CID 10103893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).