C30H38N2O10 — CID 101039037
1-O,3-O-dibenzyl 1-O-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl] (2S)-2-hydroxypropane-1,1,3-tricarboxylate (PubChem CID 101039037) has the molecular formula C30H38N2O10 and a molecular weight of 586.64 g/mol. Its IUPAC name is 1-O,3-O-dibenzyl 1-O-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl] (2S)-2-hydroxypropane-1,1,3-tricarboxylate.
| Compound Name | 1-O,3-O-dibenzyl 1-O-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl] (2S)-2-hydroxypropane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 101039037 |
| Molecular Formula | C30H38N2O10 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 1-O,3-O-dibenzyl 1-O-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl] (2S)-2-hydroxypropane-1,1,3-tricarboxylate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)NCCOC(=O)C(C(=O)OCc1ccccc1)[C@@H](O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H38N2O10/c1-20(32-29(38)42-30(2,3)4)26(35)31-15-16-39-27(36)25(28(37)41-19-22-13-9-6-10-14-22)23(33)17-24(34)40-18-21-11-7-5-8-12-21/h5-14,20,23,25,33H,15-19H2,1-4H3,(H,31,35)(H,32,38)/t20-,23-,25?/m0/s1 |
| InChIKey | MUQATSVAQGEMSV-USTNKWEJSA-N |
| XLogP | 2.41 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|