C11H11NO2 — CID 10103966
(3aS,6aS)-3-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole (PubChem CID 10103966) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (3aS,6aS)-3-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole.
| Compound Name | (3aS,6aS)-3-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 10103966 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (3aS,6aS)-3-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole |
| SMILES | c1ccc(C2=NO[C@@H]3COC[C@H]23)cc1 |
| InChI | InChI=1S/C11H11NO2/c1-2-4-8(5-3-1)11-9-6-13-7-10(9)14-12-11/h1-5,9-10H,6-7H2/t9-,10+/m0/s1 |
| InChIKey | KTKOPTCKLXRUOS-VHSXEESVSA-N |
| XLogP | 1.44 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |