About 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine
4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine (PubChem CID 101039998) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine.
Molecular Properties
| Compound Name | 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine |
| PubChem CID | 101039998 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine |
| SMILES | COC1O/C(=N\c2ccccc2)C12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C19H23NO2/c1-21-18-19(17(22-18)20-16-5-3-2-4-6-16)14-8-12-7-13(10-14)11-15(19)9-12/h2-6,12-15,18H,7-11H2,1H3/b20-17- |
| InChIKey | VFWOEYTWWVARSF-JZJYNLBNSA-N |
| XLogP | 4.16 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine?
The IUPAC name of 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine (CID 101039998) is 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine.
What is the SMILES notation for 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine?
The canonical SMILES for 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine is COC1O/C(=N\c2ccccc2)C12C1CC3CC(C1)CC2C3.
What is the InChIKey of 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine?
The InChIKey is VFWOEYTWWVARSF-JZJYNLBNSA-N. The full InChI is InChI=1S/C19H23NO2/c1-21-18-19(17(22-18)20-16-5-3-2-4-6-16)14-8-12-7-13(10-14)11-15(19)9-12/h2-6,12-15,18H,7-11H2,1H3/b20-17-.
What are the key properties of 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine?
4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine has a molecular weight of 297.40 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-methoxy-N-phenylspiro[adamantane-2,3'-oxetane]-2'-imine is sourced from PubChem (CID 101039998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).