C16H22O5Si — CID 101040019
(1S,4R,5R)-1-[(4-methoxyphenyl)-trimethylsilyloxymethyl]-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one (PubChem CID 101040019) has the molecular formula C16H22O5Si and a molecular weight of 322.43 g/mol. Its IUPAC name is (1S,4R,5R)-1-[(4-methoxyphenyl)-trimethylsilyloxymethyl]-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,4R,5R)-1-[(4-methoxyphenyl)-trimethylsilyloxymethyl]-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 101040019 |
| Molecular Formula | C16H22O5Si |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (1S,4R,5R)-1-[(4-methoxyphenyl)-trimethylsilyloxymethyl]-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| SMILES | COc1ccc(C(O[Si](C)(C)C)[C@@]23O[C@@H]2[C@@H](C)OC3=O)cc1 |
| InChI | InChI=1S/C16H22O5Si/c1-10-13-16(20-13,15(17)19-10)14(21-22(3,4)5)11-6-8-12(18-2)9-7-11/h6-10,13-14H,1-5H3/t10-,13-,14?,16+/m1/s1 |
| InChIKey | SMJPMEDFPCAXIE-WZJFGWBNSA-N |
| XLogP | 2.67 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|