C15H16ClF4NO — CID 101040061
3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-3-methyl-1-(trifluoromethyl)cyclobutane-1-carboxamide (PubChem CID 101040061) has the molecular formula C15H16ClF4NO and a molecular weight of 337.74 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-3-methyl-1-(trifluoromethyl)cyclobutane-1-carboxamide.
| Compound Name | 3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-3-methyl-1-(trifluoromethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 101040061 |
| Molecular Formula | C15H16ClF4NO |
| Molecular Weight | 337.74 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-3-methyl-1-(trifluoromethyl)cyclobutane-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C1(C(F)(F)F)CC(C)(Cl)C1)c1ccccc1F |
| InChI | InChI=1S/C15H16ClF4NO/c1-9(10-5-3-4-6-11(10)17)21-12(22)14(15(18,19)20)7-13(2,16)8-14/h3-6,9H,7-8H2,1-2H3,(H,21,22)/t9-,13?,14?/m1/s1 |
| InChIKey | ANJJGNHJHSZLIQ-BZFQTPOWSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.74 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|