About tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate
tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate (PubChem CID 10104013) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate |
| PubChem CID | 10104013 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](O)CO |
| InChI | InChI=1S/C8H17NO4/c1-8(2,3)13-7(12)9-4-6(11)5-10/h6,10-11H,4-5H2,1-3H3,(H,9,12)/t6-/m1/s1 |
| InChIKey | OWAMQHJPVUGZSB-ZCFIWIBFSA-N |
| XLogP | -0.14 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate?
The IUPAC name of tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate (CID 10104013) is tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate.
What is the SMILES notation for tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate?
The canonical SMILES for tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate is CC(C)(C)OC(=O)NC[C@@H](O)CO.
What is the InChIKey of tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate?
The InChIKey is OWAMQHJPVUGZSB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H17NO4/c1-8(2,3)13-7(12)9-4-6(11)5-10/h6,10-11H,4-5H2,1-3H3,(H,9,12)/t6-/m1/s1.
What are the key properties of tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate?
tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate has a molecular weight of 191.23 g/mol, XLogP of -0.14, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2R)-2,3-dihydroxypropyl]carbamate is sourced from PubChem (CID 10104013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).