About CID 101040268
CID 101040268 (PubChem CID 101040268) has the molecular formula C25H20N4PbS-
and a molecular weight of 615.73 g/mol.
Molecular Properties
| Compound Name | CID 101040268 |
| PubChem CID | 101040268 |
| Molecular Formula | C25H20N4PbS- |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | — |
| SMILES | [Pb].[S-]c1nnnn1-c1ccccc1.[c]1ccccc1.[c]1ccccc1.[c]1ccccc1 |
| InChI | InChI=1S/C7H6N4S.3C6H5.Pb/c12-7-8-9-10-11(7)6-4-2-1-3-5-6;3*1-2-4-6-5-3-1;/h1-5H,(H,8,10,12);3*1-5H;/p-1 |
| InChIKey | HHDRIIRCRYCIRU-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 101040268 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101040268?
The IUPAC name of CID 101040268 (CID 101040268) is not available.
What is the SMILES notation for CID 101040268?
The canonical SMILES for CID 101040268 is [Pb].[S-]c1nnnn1-c1ccccc1.[c]1ccccc1.[c]1ccccc1.[c]1ccccc1.
What is the InChIKey of CID 101040268?
The InChIKey is HHDRIIRCRYCIRU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N4S.3C6H5.Pb/c12-7-8-9-10-11(7)6-4-2-1-3-5-6;3*1-2-4-6-5-3-1;/h1-5H,(H,8,10,12);3*1-5H;/p-1.
What are the key properties of CID 101040268?
CID 101040268 has a molecular weight of 615.73 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101040268 is sourced from PubChem (CID 101040268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).