C34H30 — CID 101040367
(1R,2S,4R,5S,16R,17S,19R,20S)-3,18-dimethyldecacyclo[18.10.1.15,16.02,19.03,18.04,17.06,15.08,13.021,30.023,28]dotriaconta-6,8,10,12,14,21,23,25,27,29-decaene (PubChem CID 101040367) has the molecular formula C34H30 and a molecular weight of 438.61 g/mol. Its IUPAC name is (1R,2S,4R,5S,16R,17S,19R,20S)-3,18-dimethyldecacyclo[18.10.1.15,16.02,19.03,18.04,17.06,15.08,13.021,30.023,28]dotriaconta-6,8,10,12,14,21,23,25,27,29-decaene.
| Compound Name | (1R,2S,4R,5S,16R,17S,19R,20S)-3,18-dimethyldecacyclo[18.10.1.15,16.02,19.03,18.04,17.06,15.08,13.021,30.023,28]dotriaconta-6,8,10,12,14,21,23,25,27,29-decaene |
|---|---|
| PubChem CID | 101040367 |
| Molecular Formula | C34H30 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (1R,2S,4R,5S,16R,17S,19R,20S)-3,18-dimethyldecacyclo[18.10.1.15,16.02,19.03,18.04,17.06,15.08,13.021,30.023,28]dotriaconta-6,8,10,12,14,21,23,25,27,29-decaene |
| SMILES | CC12[C@@H]3[C@@H]([C@@H]4C[C@H]3c3cc5ccccc5cc34)C1(C)[C@@H]1[C@H]2[C@@H]2C[C@H]1c1cc3ccccc3cc12 |
| InChI | InChI=1S/C34H30/c1-33-29-25-15-27(23-13-19-9-5-3-7-17(19)11-21(23)25)31(29)34(33,2)32-28-16-26(30(32)33)22-12-18-8-4-6-10-20(18)14-24(22)28/h3-14,25-32H,15-16H2,1-2H3/t25-,26+,27+,28-,29-,30+,31+,32-,33?,34? |
| InChIKey | LIKJHBRTXKJZKH-ZVJSSVMBSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'} |
|---|