C25H21F2NO3 — CID 101040560
(4S,5S)-2-[3,3-bis(4-fluorophenyl)oxiran-2-yl]-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 101040560) has the molecular formula C25H21F2NO3 and a molecular weight of 421.44 g/mol. Its IUPAC name is (4S,5S)-2-[3,3-bis(4-fluorophenyl)oxiran-2-yl]-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-2-[3,3-bis(4-fluorophenyl)oxiran-2-yl]-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101040560 |
| Molecular Formula | C25H21F2NO3 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (4S,5S)-2-[3,3-bis(4-fluorophenyl)oxiran-2-yl]-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | COC[C@@H]1N=C(C2OC2(c2ccc(F)cc2)c2ccc(F)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H21F2NO3/c1-29-15-21-22(16-5-3-2-4-6-16)30-24(28-21)23-25(31-23,17-7-11-19(26)12-8-17)18-9-13-20(27)14-10-18/h2-14,21-23H,15H2,1H3/t21-,22-,23?/m0/s1 |
| InChIKey | KTSHNFZPBAIPGI-OJSMNCEXSA-N |
| XLogP | 4.79 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|