C20H21ClNO2- — CID 101040563
(2R)-2-chloro-1,1-diphenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethanolate (PubChem CID 101040563) has the molecular formula C20H21ClNO2- and a molecular weight of 342.85 g/mol. Its IUPAC name is (2R)-2-chloro-1,1-diphenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethanolate.
| Compound Name | (2R)-2-chloro-1,1-diphenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethanolate |
|---|---|
| PubChem CID | 101040563 |
| Molecular Formula | C20H21ClNO2- |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (2R)-2-chloro-1,1-diphenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethanolate |
| SMILES | CC(C)C1COC([C@H](Cl)C([O-])(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H21ClNO2/c1-14(2)17-13-24-19(22-17)18(21)20(23,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17-18H,13H2,1-2H3/q-1/t17?,18-/m0/s1 |
| InChIKey | ZVJCXWVXDJYLLZ-ZVAWYAOSSA-N |
| XLogP | 3.35 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|