C10H16O — CID 101040791
(5S)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylidene)-5-methylcyclohexan-1-one (PubChem CID 101040791) has the molecular formula C10H16O and a molecular weight of 158.27 g/mol. Its IUPAC name is (5S)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylidene)-5-methylcyclohexan-1-one.
| Compound Name | (5S)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylidene)-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 101040791 |
| Molecular Formula | C10H16O |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.16 |
| IUPAC Name | (5S)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylidene)-5-methylcyclohexan-1-one |
| SMILES | [2H]C([2H])([2H])C(=C1CC[C@H](C)CC1=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m0/s1/i1D3,2D3 |
| InChIKey | NZGWDASTMWDZIW-SDRFOMIYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|