C12H16O3 — CID 101041220
2,2-diethyl-6-methyl-3H-furo[3,2-c]pyran-4-one (PubChem CID 101041220) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,2-diethyl-6-methyl-3H-furo[3,2-c]pyran-4-one.
| Compound Name | 2,2-diethyl-6-methyl-3H-furo[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 101041220 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2,2-diethyl-6-methyl-3H-furo[3,2-c]pyran-4-one |
| SMILES | CCC1(CC)Cc2c(cc(C)oc2=O)O1 |
| InChI | InChI=1S/C12H16O3/c1-4-12(5-2)7-9-10(15-12)6-8(3)14-11(9)13/h6H,4-5,7H2,1-3H3 |
| InChIKey | XLCVPATZQKKUTO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |