1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide

C6H7Cl2OP — CID 10104156

IUPAC1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide
SMILESCC1=CP(=O)(Cl)CC=C1Cl
InChIInChI=1S/C6H7Cl2OP/c1-5-4-10(8,9)3-2-6(5)7/h2,4H,3H2,1H3
InChIKeyRPEKGAAYOZWLHE-UHFFFAOYSA-N
MW197.00 g/mol
LogP3.54
Rot. Bonds

About 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide

1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide (PubChem CID 10104156) has the molecular formula C6H7Cl2OP and a molecular weight of 197.00 g/mol. Its IUPAC name is 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide.

Molecular Properties

Compound Name1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide
PubChem CID10104156
Molecular FormulaC6H7Cl2OP
Molecular Weight197.00 g/mol
Exact Mass195.96
IUPAC Name1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide
SMILESCC1=CP(=O)(Cl)CC=C1Cl
InChIInChI=1S/C6H7Cl2OP/c1-5-4-10(8,9)3-2-6(5)7/h2,4H,3H2,1H3
InChIKeyRPEKGAAYOZWLHE-UHFFFAOYSA-N
XLogP3.54
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.00
LogP ≤ 53.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide?
The IUPAC name of 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide (CID 10104156) is 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide.
What is the SMILES notation for 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide?
The canonical SMILES for 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide is CC1=CP(=O)(Cl)CC=C1Cl.
What is the InChIKey of 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide?
The InChIKey is RPEKGAAYOZWLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2OP/c1-5-4-10(8,9)3-2-6(5)7/h2,4H,3H2,1H3.
What are the key properties of 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide?
1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide has a molecular weight of 197.00 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichloro-5-methyl-2H-1lambda5-phosphinine 1-oxide is sourced from PubChem (CID 10104156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).