C22H16F18N2O2 — CID 101041721
1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 101041721) has the molecular formula C22H16F18N2O2 and a molecular weight of 682.35 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 101041721 |
| Molecular Formula | C22H16F18N2O2 |
| Molecular Weight | 682.35 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)C1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H16F18N2O2/c23-15(24,17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)22(38,39)40)14(44)42-6-4-11(5-7-42)13(43)41-9-10-2-1-3-12(8-10)16(25,26)27/h1-3,8,11H,4-7,9H2,(H,41,43) |
| InChIKey | FPIPIHFGTGEACI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.35 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|