About 2,3-dimethylpyrazino[2,3-b]phenazine
2,3-dimethylpyrazino[2,3-b]phenazine (PubChem CID 101041837) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2,3-dimethylpyrazino[2,3-b]phenazine.
Molecular Properties
| Compound Name | 2,3-dimethylpyrazino[2,3-b]phenazine |
| PubChem CID | 101041837 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2,3-dimethylpyrazino[2,3-b]phenazine |
| SMILES | Cc1nc2cc3nc4ccccc4nc3cc2nc1C |
| InChI | InChI=1S/C16H12N4/c1-9-10(2)18-14-8-16-15(7-13(14)17-9)19-11-5-3-4-6-12(11)20-16/h3-8H,1-2H3 |
| InChIKey | MANHBUITBQXFJZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylpyrazino[2,3-b]phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpyrazino[2,3-b]phenazine?
The IUPAC name of 2,3-dimethylpyrazino[2,3-b]phenazine (CID 101041837) is 2,3-dimethylpyrazino[2,3-b]phenazine.
What is the SMILES notation for 2,3-dimethylpyrazino[2,3-b]phenazine?
The canonical SMILES for 2,3-dimethylpyrazino[2,3-b]phenazine is Cc1nc2cc3nc4ccccc4nc3cc2nc1C.
What is the InChIKey of 2,3-dimethylpyrazino[2,3-b]phenazine?
The InChIKey is MANHBUITBQXFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c1-9-10(2)18-14-8-16-15(7-13(14)17-9)19-11-5-3-4-6-12(11)20-16/h3-8H,1-2H3.
What are the key properties of 2,3-dimethylpyrazino[2,3-b]phenazine?
2,3-dimethylpyrazino[2,3-b]phenazine has a molecular weight of 260.30 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpyrazino[2,3-b]phenazine is sourced from PubChem (CID 101041837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).