C17H28N2O3S — CID 101042097
tert-butyl N-[(2R,3R,4S,5E,7E)-8-cyano-4-ethylsulfanyl-3-methoxyocta-5,7-dien-2-yl]carbamate (PubChem CID 101042097) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4S,5E,7E)-8-cyano-4-ethylsulfanyl-3-methoxyocta-5,7-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4S,5E,7E)-8-cyano-4-ethylsulfanyl-3-methoxyocta-5,7-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 101042097 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | tert-butyl N-[(2R,3R,4S,5E,7E)-8-cyano-4-ethylsulfanyl-3-methoxyocta-5,7-dien-2-yl]carbamate |
| SMILES | CCS[C@@H](/C=C/C=C/C#N)[C@H](OC)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O3S/c1-7-23-14(11-9-8-10-12-18)15(21-6)13(2)19-16(20)22-17(3,4)5/h8-11,13-15H,7H2,1-6H3,(H,19,20)/b10-8+,11-9+/t13-,14+,15-/m1/s1 |
| InChIKey | XRUPBMLJEPBDSY-YTQRWKNZSA-N |
| XLogP | 3.67 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|