C8H13NO2 — CID 101042261
(4aR,7aS)-1-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyridin-4-one (PubChem CID 101042261) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (4aR,7aS)-1-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyridin-4-one.
| Compound Name | (4aR,7aS)-1-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 101042261 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (4aR,7aS)-1-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyridin-4-one |
| SMILES | CN1CCC(=O)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C8H13NO2/c1-9-3-2-8(10)6-4-11-5-7(6)9/h6-7H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | DSQZBYBERKLIAC-NKWVEPMBSA-N |
| XLogP | -0.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |