C8H16OS — CID 101042409
(3S,4S)-3-propylthian-4-ol (PubChem CID 101042409) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is (3S,4S)-3-propylthian-4-ol.
| Compound Name | (3S,4S)-3-propylthian-4-ol |
|---|---|
| PubChem CID | 101042409 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3S,4S)-3-propylthian-4-ol |
| SMILES | CCC[C@@H]1CSCC[C@@H]1O |
| InChI | InChI=1S/C8H16OS/c1-2-3-7-6-10-5-4-8(7)9/h7-9H,2-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | WVZYRVLQRHKKRG-SFYZADRCSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |