About 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]
3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] (PubChem CID 10104253) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole].
Molecular Properties
| Compound Name | 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] |
| PubChem CID | 10104253 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] |
| SMILES | CN1C=NC2(CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C13H16N2/c1-15-9-13(14-10-15)7-6-11-4-2-3-5-12(11)8-13/h2-5,10H,6-9H2,1H3 |
| InChIKey | NPOOTUJUMPZTKY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]?
The IUPAC name of 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] (CID 10104253) is 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole].
What is the SMILES notation for 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]?
The canonical SMILES for 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] is CN1C=NC2(CCc3ccccc3C2)C1.
What is the InChIKey of 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]?
The InChIKey is NPOOTUJUMPZTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-15-9-13(14-10-15)7-6-11-4-2-3-5-12(11)8-13/h2-5,10H,6-9H2,1H3.
What are the key properties of 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]?
3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] has a molecular weight of 200.29 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole] is sourced from PubChem (CID 10104253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).