C38H50O8P2 — CID 101042561
16,24-bis(diethoxyphosphoryl)-3,3,10,12,19,19,23-heptamethyl-8,14-dioxahexacyclo[13.5.2.24,7.19,13.01,5.018,21]pentacosa-4(25),5,7(24),9(23),10,12,15,17,21-nonaene (PubChem CID 101042561) has the molecular formula C38H50O8P2 and a molecular weight of 696.76 g/mol. Its IUPAC name is 16,24-bis(diethoxyphosphoryl)-3,3,10,12,19,19,23-heptamethyl-8,14-dioxahexacyclo[13.5.2.24,7.19,13.01,5.018,21]pentacosa-4(25),5,7(24),9(23),10,12,15,17,21-nonaene.
| Compound Name | 16,24-bis(diethoxyphosphoryl)-3,3,10,12,19,19,23-heptamethyl-8,14-dioxahexacyclo[13.5.2.24,7.19,13.01,5.018,21]pentacosa-4(25),5,7(24),9(23),10,12,15,17,21-nonaene |
|---|---|
| PubChem CID | 101042561 |
| Molecular Formula | C38H50O8P2 |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.30 |
| IUPAC Name | 16,24-bis(diethoxyphosphoryl)-3,3,10,12,19,19,23-heptamethyl-8,14-dioxahexacyclo[13.5.2.24,7.19,13.01,5.018,21]pentacosa-4(25),5,7(24),9(23),10,12,15,17,21-nonaene |
| SMILES | CCOP(=O)(OCC)c1cc2c3cc1Oc1c(C)cc(C)c(c1C)Oc1cc4c(cc1P(=O)(OCC)OCC)C(C)(C)CC34CC2(C)C |
| InChI | InChI=1S/C38H50O8P2/c1-12-41-47(39,42-13-2)32-19-26-28-17-30(32)45-34-23(5)16-24(6)35(25(34)7)46-31-18-29-27(20-33(31)48(40,43-14-3)44-15-4)37(10,11)22-38(28,29)21-36(26,8)9/h16-20H,12-15,21-22H2,1-11H3 |
| InChIKey | ZQCDDBCGRNCYTK-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|