C10H11N5 — CID 10104269
2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine (PubChem CID 10104269) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine.
| Compound Name | 2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine |
|---|---|
| PubChem CID | 10104269 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine |
| SMILES | Nc1nc(N)c2cc3c(nc2n1)CCC3 |
| InChI | InChI=1S/C10H11N5/c11-8-6-4-5-2-1-3-7(5)13-9(6)15-10(12)14-8/h4H,1-3H2,(H4,11,12,13,14,15) |
| InChIKey | BKWKQFQZAASHJC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |