C23H41BN4O4 — CID 101043120
tert-butyl 4-[2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]piperazine-1-carboxylate (PubChem CID 101043120) has the molecular formula C23H41BN4O4 and a molecular weight of 448.42 g/mol. Its IUPAC name is tert-butyl 4-[2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 101043120 |
| Molecular Formula | C23H41BN4O4 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | tert-butyl 4-[2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(CN1CCN(C(=O)OC(C)(C)C)CC1)Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C23H41BN4O4/c1-20(2,3)30-19(29)27-12-10-26(11-13-27)16-21(4,5)17-28-15-18(14-25-28)24-31-22(6,7)23(8,9)32-24/h14-15H,10-13,16-17H2,1-9H3 |
| InChIKey | VDSYXAZXWYTZOY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|