About 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane
2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane (PubChem CID 10104321) has the molecular formula C10H18O2S
and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane.
Molecular Properties
| Compound Name | 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane |
| PubChem CID | 10104321 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane |
| SMILES | C[C@H]1CSC[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C10H18O2S/c1-8-6-13-7-9(8)12-10-4-2-3-5-11-10/h8-10H,2-7H2,1H3/t8-,9+,10?/m0/s1 |
| InChIKey | UPSYALGUNBTAGK-QIIDTADFSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane?
The IUPAC name of 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane (CID 10104321) is 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane.
What is the SMILES notation for 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane?
The canonical SMILES for 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane is C[C@H]1CSC[C@H]1OC1CCCCO1.
What is the InChIKey of 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane?
The InChIKey is UPSYALGUNBTAGK-QIIDTADFSA-N. The full InChI is InChI=1S/C10H18O2S/c1-8-6-13-7-9(8)12-10-4-2-3-5-11-10/h8-10H,2-7H2,1H3/t8-,9+,10?/m0/s1.
What are the key properties of 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane?
2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane has a molecular weight of 202.32 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-4-methylthiolan-3-yl]oxyoxane is sourced from PubChem (CID 10104321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).