About 2,3-dihydro-1H-indene-1,3-dicarboxylic acid
2,3-dihydro-1H-indene-1,3-dicarboxylic acid (PubChem CID 10104419) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indene-1,3-dicarboxylic acid |
| PubChem CID | 10104419 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2,3-dihydro-1H-indene-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C11H10O4/c12-10(13)8-5-9(11(14)15)7-4-2-1-3-6(7)8/h1-4,8-9H,5H2,(H,12,13)(H,14,15) |
| InChIKey | MNQNHAXVLUCZMI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-indene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indene-1,3-dicarboxylic acid?
The IUPAC name of 2,3-dihydro-1H-indene-1,3-dicarboxylic acid (CID 10104419) is 2,3-dihydro-1H-indene-1,3-dicarboxylic acid.
What is the SMILES notation for 2,3-dihydro-1H-indene-1,3-dicarboxylic acid?
The canonical SMILES for 2,3-dihydro-1H-indene-1,3-dicarboxylic acid is O=C(O)C1CC(C(=O)O)c2ccccc21.
What is the InChIKey of 2,3-dihydro-1H-indene-1,3-dicarboxylic acid?
The InChIKey is MNQNHAXVLUCZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c12-10(13)8-5-9(11(14)15)7-4-2-1-3-6(7)8/h1-4,8-9H,5H2,(H,12,13)(H,14,15).
What are the key properties of 2,3-dihydro-1H-indene-1,3-dicarboxylic acid?
2,3-dihydro-1H-indene-1,3-dicarboxylic acid has a molecular weight of 206.20 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene-1,3-dicarboxylic acid is sourced from PubChem (CID 10104419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).